EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:749718 - razupenem
| Formula | C18H21N3O4S2 |
| Net Charge | 0 |
| Average Mass | 407.517 |
| Monoisotopic Mass | 407.09735 |
| SMILES | [H][C@]12[C@@H](C)C(Sc3nc(C4=C[C@H](C)NC4)cs3)=C(C(=O)O)N1C(=O)[C@]2([H])[C@@H](C)O |
| InChI | InChI=1S/C18H21N3O4S2/c1-7-4-10(5-19-7)11-6-26-18(20-11)27-15-8(2)13-12(9(3)22)16(23)21(13)14(15)17(24)25/h4,6-9,12-13,19,22H,5H2,1-3H3,(H,24,25)/t7-,8+,9+,12+,13+/m0/s1 |
| InChIKey | XFGOMLIRJYURLQ-GOKYHWASSA-N |
| Roles Classification |
|---|
| Biological Roles: | antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| Application: | antiinfective agent A substance used in the prophylaxis or therapy of infectious diseases. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| razupenem (CHEBI:749718) has role antiinfective agent (CHEBI:35441) |
| razupenem (CHEBI:749718) is a carbapenems (CHEBI:46633) |
| INN | Source |
|---|---|
| razupenem | WHO MedNet |
| Synonyms | Source |
|---|---|
| PTZ-601 | ChEMBL |
| PTZ601 | ChEMBL |
| PZ-601 | ChEMBL |
| PZ601 | ChEMBL |
| SM-216601 | ChEMBL |
| SM216601 | ChEMBL |
| Citations |
|---|