EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
We are looking for a new Chemistry curator to join the ChEBI team. Find out more about it here.
CHEBI:749717 - itriglumide
| Formula | C33H38N2O4 |
| Net Charge | 0 |
| Average Mass | 526.677 |
| Monoisotopic Mass | 526.28316 |
| SMILES | Cc1cc(C)c(NC(=O)C[C@H](CC(=O)O)c2cccc3ccccc23)c(C(=O)N2CCC3(CCCC3)CC2)c1 |
| InChI | InChI=1S/C33H38N2O4/c1-22-18-23(2)31(28(19-22)32(39)35-16-14-33(15-17-35)12-5-6-13-33)34-29(36)20-25(21-30(37)38)27-11-7-9-24-8-3-4-10-26(24)27/h3-4,7-11,18-19,25H,5-6,12-17,20-21H2,1-2H3,(H,34,36)(H,37,38)/t25-/m1/s1 |
| InChIKey | MFOOVZCXWVAWOV-RUZDIDTESA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| itriglumide (CHEBI:749717) is a N-acylpiperidine (CHEBI:48591) |
| INNs | Source |
|---|---|
| itriglumida | WHO MedNet |
| itriglumide | WHO MedNet |
| Synonyms | Source |
|---|---|
| Cr-2945 | ChEMBL |
| (+)-CR-2945 | ChEMBL |
| Citations |
|---|