EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | HCl.C6H9N3O2 |
| Net Charge | 0 |
| Average Mass | 191.618 |
| Monoisotopic Mass | 191.04615 |
| SMILES | Cl.N[C@@H](Cc1cncn1)C(=O)O |
| InChI | InChI=1S/C6H9N3O2.ClH/c7-5(6(10)11)1-4-2-8-3-9-4;/h2-3,5H,1,7H2,(H,8,9)(H,10,11);1H/t5-;/m0./s1 |
| InChIKey | QZNNVYOVQUKYSC-JEDNCBNOSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| histidine monohydrochloride (CHEBI:749713) is a α-amino acid (CHEBI:33704) |
| Synonyms | Source |
|---|---|
| Histidine hydrochloride | ChEMBL |
| Histidine monohydrochloride | ChEMBL |
| NSC-257867 | ChEMBL |
| Brand Names | Source |
|---|---|
| Osmhydran ls 8453 | ChEMBL |
| Photonyl | ChEMBL |
| P.p.a.a. | ChEMBL |
| Sunactyl ls 9610 | ChEMBL |
| Citations |
|---|