EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
We are looking for a new Chemistry curator to join the ChEBI team. Find out more about it here.
CHEBI:749711 - quinpirole hydrochloride
| Formula | HCl.C13H21N3 |
| Net Charge | 0 |
| Average Mass | 255.793 |
| Monoisotopic Mass | 255.15023 |
| SMILES | Cl.[H][C@]12CCCN(CCC)[C@]1([H])Cc1cnnc1C2 |
| InChI | InChI=1S/C13H21N3.ClH/c1-2-5-16-6-3-4-10-7-12-11(8-13(10)16)9-14-15-12;/h9-10,13H,2-8H2,1H3,(H,14,15);1H/t10-,13-;/m1./s1 |
| InChIKey | HJHVRVJTYPKTHX-HTMVYDOJSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| quinpirole hydrochloride (CHEBI:749711) is a piperidines (CHEBI:26151) |
| Synonyms | Source |
|---|---|
| LY-171555 | ChEMBL |
| LY171555 | ChEMBL |
| Quinpirole hcl | ChEMBL |
| Quinpirole hydrochloride | ChEMBL |
| Citations |
|---|