EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | HCl.C9H13N3O5 |
| Net Charge | 0 |
| Average Mass | 279.680 |
| Monoisotopic Mass | 279.06220 |
| SMILES | Cl.Nc1ccn([C@@H]2O[C@H](CO)[C@@H](O)[C@@H]2O)c(=O)n1 |
| InChI | InChI=1S/C9H13N3O5.ClH/c10-5-1-2-12(9(16)11-5)8-7(15)6(14)4(3-13)17-8;/h1-2,4,6-8,13-15H,3H2,(H2,10,11,16);1H/t4-,6-,7+,8-;/m1./s1 |
| InChIKey | KCURWTAZOZXKSJ-JBMRGDGGSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cytarabine hydrochloride (CHEBI:749710) has role antineoplastic agent (CHEBI:35610) |
| cytarabine hydrochloride (CHEBI:749710) is a pyrimidine nucleoside (CHEBI:26440) |
| Synonyms | Source |
|---|---|
| Cytosine arabinoside hydrochloride | ChEMBL |
| NSC-63878 | ChEMBL |
| U-19920A | ChEMBL |
| Citations |
|---|