EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
We are looking for a new Chemistry curator to join the ChEBI team. Find out more about it here.
CHEBI:749706 - pimagedine hydrochloride
| Formula | HCl.CH6N4 |
| Net Charge | 0 |
| Average Mass | 110.548 |
| Monoisotopic Mass | 110.03592 |
| SMILES | Cl.N=C(N)NN |
| InChI | InChI=1S/CH6N4.ClH/c2-1(3)5-4;/h4H2,(H4,2,3,5);1H |
| InChIKey | UBDZFAGVPPMTIT-UHFFFAOYSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pimagedine hydrochloride (CHEBI:749706) is a guanidines (CHEBI:24436) |
| Synonyms | Source |
|---|---|
| Aminoguanidine hcl | ChEMBL |
| Aminoguanidine hydrochloride | ChEMBL |
| GER-11 | ChEMBL |
| NSC-760398 | ChEMBL |
| Pimagedine hcl | ChEMBL |
| Pimagedine hydrochloride | ChEMBL |
| Citations |
|---|