EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
We are looking for a new Chemistry curator to join the ChEBI team. Find out more about it here.
CHEBI:749704 - tilarginine acetate
| Formula | C7H16N4O2.C2H4O2 |
| Net Charge | 0 |
| Average Mass | 248.283 |
| Monoisotopic Mass | 248.14846 |
| SMILES | CC(=O)O.CNC(=N)NCCC[C@H](N)C(=O)O |
| InChI | InChI=1S/C7H16N4O2.C2H4O2/c1-10-7(9)11-4-2-3-5(8)6(12)13;1-2(3)4/h5H,2-4,8H2,1H3,(H,12,13)(H3,9,10,11);1H3,(H,3,4)/t5-;/m0./s1 |
| InChIKey | IKPNWIGTWUZCKM-JEDNCBNOSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tilarginine acetate (CHEBI:749704) is a arginine derivative (CHEBI:22617) |
| Synonyms | Source |
|---|---|
| ANO-1020 | ChEMBL |
| L-nmma acetate | ChEMBL |
| Ng-methylarginine acetate | ChEMBL |
| Ng-methyl-l-arginine acetate salt | ChEMBL |
| Ng-monomethyl-l-arginine acetate | ChEMBL |
| Targinine acetate | ChEMBL |
| Citations |
|---|