EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
We are looking for a new Chemistry curator to join the ChEBI team. Find out more about it here.
CHEBI:749702 - glutamic acid hydrochloride
| Formula | HCl.C5H9NO4 |
| Net Charge | 0 |
| Average Mass | 183.591 |
| Monoisotopic Mass | 183.02984 |
| SMILES | Cl.N[C@@H](CCC(=O)O)C(=O)O |
| InChI | InChI=1S/C5H9NO4.ClH/c6-3(5(9)10)1-2-4(7)8;/h3H,1-2,6H2,(H,7,8)(H,9,10);1H/t3-;/m0./s1 |
| InChIKey | RPAJSBKBKSSMLJ-DFWYDOINSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| glutamic acid hydrochloride (CHEBI:749702) is a glutamic acid derivative (CHEBI:24315) |
| Synonyms | Source |
|---|---|
| L-glutamic acid hydrochloride | ChEMBL |
| NSC-9239 | ChEMBL |
| Brand Name | Source |
|---|---|
| Muripsin | ChEMBL |
| Citations |
|---|