EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H38O4 |
| Net Charge | 0 |
| Average Mass | 378.553 |
| Monoisotopic Mass | 378.27701 |
| SMILES | [H][C@@]12C[C@H](O)CC[C@]1(C)[C@@]1([H])CC[C@@]3(C)[C@@]([H])(CC[C@]3([H])[C@H](C)CC(=O)O)[C@]1([H])[C@@H](O)C2 |
| InChI | InChI=1S/C23H38O4/c1-13(10-20(26)27)16-4-5-17-21-18(7-9-23(16,17)3)22(2)8-6-15(24)11-14(22)12-19(21)25/h13-19,21,24-25H,4-12H2,1-3H3,(H,26,27)/t13-,14+,15-,16-,17+,18+,19+,21+,22+,23-/m1/s1 |
| InChIKey | QYYDXDSPYPOWRO-JHMCBHKWSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| norucholic acid (CHEBI:749698) is a bile acid (CHEBI:3098) |
| INNs | Source |
|---|---|
| acide norucholique | WHO MedNet |
| acido norucolico | WHO MedNet |
| norucholic acid | WHO MedNet |
| Synonyms | Source |
|---|---|
| 24-norursodeoxycholic acid | ChEMBL |
| Nor-ursodeoxycholic acid | ChEMBL |
| Norursodeoxycholic acid | ChEMBL |
| Citations |
|---|