EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H31ClN6 |
| Net Charge | 0 |
| Average Mass | 487.051 |
| Monoisotopic Mass | 486.22987 |
| SMILES | Clc1ccc2c(NCCCN3CCC(NC(c4ccccn4)c4ccccn4)CC3)ccnc2c1 |
| InChI | InChI=1S/C28H31ClN6/c29-21-8-9-23-24(10-16-33-27(23)20-21)30-15-5-17-35-18-11-22(12-19-35)34-28(25-6-1-3-13-31-25)26-7-2-4-14-32-26/h1-4,6-10,13-14,16,20,22,28,34H,5,11-12,15,17-19H2,(H,30,33) |
| InChIKey | QRCZXFIANKOFOR-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | antimalarial A drug used in the treatment of malaria. Antimalarials are usually classified on the basis of their action against Plasmodia at different stages in their life cycle in the human. |
| Application: | antimalarial A drug used in the treatment of malaria. Antimalarials are usually classified on the basis of their action against Plasmodia at different stages in their life cycle in the human. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dm-1157 (CHEBI:749697) has role antimalarial (CHEBI:38068) |
| dm-1157 (CHEBI:749697) is a organohalogen compound (CHEBI:17792) |
| dm-1157 (CHEBI:749697) is a quinolines (CHEBI:26513) |
| Synonyms | Source |
|---|---|
| Dm-1157 | ChEMBL |
| DM1157 | ChEMBL |
| PL-69 | ChEMBL |
| PL69 | ChEMBL |
| Citations |
|---|