EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C29H28F4N4O4 |
| Net Charge | 0 |
| Average Mass | 572.559 |
| Monoisotopic Mass | 572.20467 |
| SMILES | [H][C@]1(CC(=O)O)c2cccc(F)c2N=C(N2CCN(c3cccc(OC)c3)CC2)N1c1cc(C(F)(F)F)ccc1OC |
| InChI | InChI=1S/C29H28F4N4O4/c1-40-20-6-3-5-19(16-20)35-11-13-36(14-12-35)28-34-27-21(7-4-8-22(27)30)23(17-26(38)39)37(28)24-15-18(29(31,32)33)9-10-25(24)41-2/h3-10,15-16,23H,11-14,17H2,1-2H3,(H,38,39)/t23-/m0/s1 |
| InChIKey | FWYSMLBETOMXAG-QHCPKHFHSA-N |
| Roles Classification |
|---|
| Biological Role: | antiviral agent A substance that destroys or inhibits replication of viruses. |
| Application: | antiinfective agent A substance used in the prophylaxis or therapy of infectious diseases. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| letermovir (CHEBI:749693) has role antiinfective agent (CHEBI:35441) |
| letermovir (CHEBI:749693) has role antiviral agent (CHEBI:22587) |
| letermovir (CHEBI:749693) is a piperazines (CHEBI:26144) |
| Synonyms | Source |
|---|---|
| AIC 246 | ChEMBL |
| AIC-246 | ChEMBL |
| AIC246 | ChEMBL |
| Letermovir | ChEMBL |
| MK-8228 | ChEMBL |
| Brand Name | Source |
|---|---|
| Prevymis | ChEMBL |
| Citations |
|---|