EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C34H39N3O6S |
| Net Charge | 0 |
| Average Mass | 617.768 |
| Monoisotopic Mass | 617.25596 |
| SMILES | CC(C)(Cc1cccc(CC(=O)NCc2cccc(-c3ccc(O)cc3)c2)c1)NC[C@H](O)c1ccc(O)c(NS(C)(=O)=O)c1 |
| InChI | InChI=1S/C34H39N3O6S/c1-34(2,36-22-32(40)28-12-15-31(39)30(19-28)37-44(3,42)43)20-24-7-4-6-23(16-24)18-33(41)35-21-25-8-5-9-27(17-25)26-10-13-29(38)14-11-26/h4-17,19,32,36-40H,18,20-22H2,1-3H3,(H,35,41)/t32-/m0/s1 |
| InChIKey | YPHDIMUXXABSSO-YTTGMZPUSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Applications: | anti-asthmatic agent Any compound that has anti-asthmatic effects. central nervous system stimulant Any drug that enhances the activity of the central nervous system. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pf-00610355 (CHEBI:749690) has role anti-asthmatic agent (CHEBI:65023) |
| pf-00610355 (CHEBI:749690) is a amphetamines (CHEBI:35338) |
| Synonyms | Source |
|---|---|
| Pf-00610355 | ChEMBL |
| PF - 00610355 | ChEMBL |
| PF-610355 | ChEMBL |
| Citations |
|---|