EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H15N5O3 |
| Net Charge | 0 |
| Average Mass | 265.273 |
| Monoisotopic Mass | 265.11749 |
| SMILES | Nc1ncnc2c([C@@H]3N[C@H](CO)[C@@H](O)[C@H]3O)cnc12 |
| InChI | InChI=1S/C11H15N5O3/c12-11-8-6(14-3-15-11)4(1-13-8)7-10(19)9(18)5(2-17)16-7/h1,3,5,7,9-10,13,16-19H,2H2,(H2,12,14,15)/t5-,7+,9-,10+/m1/s1 |
| InChIKey | AMFDITJFBUXZQN-KUBHLMPHSA-N |
| Roles Classification |
|---|
| Biological Role: | antiviral agent A substance that destroys or inhibits replication of viruses. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| galidesivir (CHEBI:749678) has role antiviral agent (CHEBI:22587) |
| galidesivir (CHEBI:749678) is a pyrrolopyrimidine (CHEBI:38670) |
| INN | Source |
|---|---|
| galidesivir | WHO MedNet |
| Synonyms | Source |
|---|---|
| BCX-4430 | ChEMBL |
| BCX4430 | ChEMBL |
| Immucillin a | ChEMBL |
| Citations |
|---|