EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C39H48N4O5 |
| Net Charge | 0 |
| Average Mass | 652.836 |
| Monoisotopic Mass | 652.36247 |
| SMILES | CC(C)(C)NC(=O)[C@@H]1CN(Cc2cc3ccccc3o2)CCN1C[C@@H](O)C[C@@H](Cc1ccccc1)C(=O)N[C@H]1c2ccccc2C[C@H]1O |
| InChI | InChI=1S/C39H48N4O5/c1-39(2,3)41-38(47)33-25-42(24-31-21-28-14-8-10-16-35(28)48-31)17-18-43(33)23-30(44)20-29(19-26-11-5-4-6-12-26)37(46)40-36-32-15-9-7-13-27(32)22-34(36)45/h4-16,21,29-30,33-34,36,44-45H,17-20,22-25H2,1-3H3,(H,40,46)(H,41,47)/t29-,30+,33+,34-,36+/m1/s1 |
| InChIKey | AOMZDQMIOCTPQP-QHQMVRJISA-N |
| Roles Classification |
|---|
| Biological Role: | anti-HIV agent An antiviral agent that destroys or inhibits the replication of the human immunodeficiency virus. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| l 756423 (CHEBI:749670) has role anti-HIV agent (CHEBI:64946) |
| l 756423 (CHEBI:749670) is a amino acid amide (CHEBI:22475) |
| Synonyms | Source |
|---|---|
| L 756423 | ChEMBL |
| L-756423 | ChEMBL |
| Citations |
|---|