EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
We are looking for a new Chemistry curator to join the ChEBI team. Find out more about it here.
CHEBI:749668 - mk-3281
| Formula | C29H37N3O3 |
| Net Charge | 0 |
| Average Mass | 475.633 |
| Monoisotopic Mass | 475.28349 |
| SMILES | CN(C)CCN(C)[C@H]1COc2ccccc2-c2c(C3CCCCC3)c3ccc(C(=O)O)cc3n2C1 |
| InChI | InChI=1S/C29H37N3O3/c1-30(2)15-16-31(3)22-18-32-25-17-21(29(33)34)13-14-23(25)27(20-9-5-4-6-10-20)28(32)24-11-7-8-12-26(24)35-19-22/h7-8,11-14,17,20,22H,4-6,9-10,15-16,18-19H2,1-3H3,(H,33,34)/t22-/m1/s1 |
| InChIKey | YQUCBFIQSJVCOR-JOCHJYFZSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | antiviral agent A substance that destroys or inhibits replication of viruses. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| mk-3281 (CHEBI:749668) has role antiviral agent (CHEBI:22587) |
| mk-3281 (CHEBI:749668) is a indolyl carboxylic acid (CHEBI:46867) |
| Synonyms | Source |
|---|---|
| Mk 3281 | ChEMBL |
| Mk-3281 | ChEMBL |
| Citations |
|---|