EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H21Cl2N3O6S |
| Net Charge | 0 |
| Average Mass | 574.442 |
| Monoisotopic Mass | 573.05281 |
| SMILES | CCC(=O)NS(=O)(=O)c1ccc(NC(=O)COc2ccc(Cl)cc2C(=O)c2cc(Cl)cc(C#N)c2)c(C)c1 |
| InChI | InChI=1S/C26H21Cl2N3O6S/c1-3-24(32)31-38(35,36)20-5-6-22(15(2)8-20)30-25(33)14-37-23-7-4-18(27)12-21(23)26(34)17-9-16(13-29)10-19(28)11-17/h4-12H,3,14H2,1-2H3,(H,30,33)(H,31,32) |
| InChIKey | GAQZNFUDILDDDI-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | anti-HIV agent An antiviral agent that destroys or inhibits the replication of the human immunodeficiency virus. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| gw-695634 (CHEBI:749666) has role anti-HIV agent (CHEBI:64946) |
| gw-695634 (CHEBI:749666) is a benzophenones (CHEBI:22726) |
| Synonyms | Source |
|---|---|
| Gw-695634 | ChEMBL |
| GW695634 | ChEMBL |
| Citations |
|---|