EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H14ClFN8 |
| Net Charge | 0 |
| Average Mass | 348.773 |
| Monoisotopic Mass | 348.10140 |
| SMILES | Cc1cc(Nc2nc(N[C@@H](C)c3ncc(F)cn3)ncc2Cl)nn1 |
| InChI | InChI=1S/C14H14ClFN8/c1-7-3-11(24-23-7)21-13-10(15)6-19-14(22-13)20-8(2)12-17-4-9(16)5-18-12/h3-6,8H,1-2H3,(H3,19,20,21,22,23,24)/t8-/m0/s1 |
| InChIKey | PDOQBOJDRPLBQU-QMMMGPOBSA-N |
| Roles Classification |
|---|
| Applications: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. antifibrotic agent Any agent which acts to reduce fibrosis. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| azd-1480 (CHEBI:749656) has role antifibrotic agent (CHEBI:233423) |
| azd-1480 (CHEBI:749656) has role antineoplastic agent (CHEBI:35610) |
| azd-1480 (CHEBI:749656) is a organohalogen compound (CHEBI:17792) |
| azd-1480 (CHEBI:749656) is a pyrimidines (CHEBI:39447) |
| Synonyms | Source |
|---|---|
| Azd 1480 | ChEMBL |
| Azd-1480 | ChEMBL |
| AZD1480 | ChEMBL |
| Citations |
|---|