EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H16N6O2 |
| Net Charge | 0 |
| Average Mass | 240.267 |
| Monoisotopic Mass | 240.13347 |
| SMILES | [H][C@]1([C@@H](O)[C@H](C)O)CNc2nc(N)nc(N)c2N1 |
| InChI | InChI=1S/C9H16N6O2/c1-3(16)6(17)4-2-12-8-5(13-4)7(10)14-9(11)15-8/h3-4,6,13,16-17H,2H2,1H3,(H5,10,11,12,14,15)/t3-,4+,6-/m0/s1 |
| InChIKey | NDSDGUULXHNXGA-RPDRRWSUSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Applications: | neuroprotective agent Any compound that can be used for the treatment of neurodegenerative disorders. renoprotective agent Any compound that is able to prevent damage to the kidneys. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ronopterin (CHEBI:749651) has role neuroprotective agent (CHEBI:63726) |
| ronopterin (CHEBI:749651) has role renoprotective agent (CHEBI:231911) |
| ronopterin (CHEBI:749651) is a secondary amine (CHEBI:32863) |
| INNs | Source |
|---|---|
| ronopterin | WHO MedNet |
| ronopterina | WHO MedNet |
| ronopterine | WHO MedNet |
| Synonyms | Source |
|---|---|
| 4-aminotetrahydrobiopterin | ChEMBL |
| Ronopterin, (6r)- | ChEMBL |
| VAS-203 | ChEMBL |
| VAS203 | ChEMBL |