EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C32H37NO13 |
| Net Charge | 0 |
| Average Mass | 643.642 |
| Monoisotopic Mass | 643.22649 |
| SMILES | [H][C@]1(O[C@@H]2[C@H](C)O[C@@]([H])(O[C@H]3C[C@](O)(C(=O)CO)Cc4c(O)c5c(c(O)c43)C(=O)c3ccccc3C5=O)C[C@@H]2O)C[C@H](N)[C@H](O)[C@H](C)O1 |
| InChI | InChI=1S/C32H37NO13/c1-12-26(37)17(33)7-21(43-12)46-31-13(2)44-22(8-18(31)35)45-19-10-32(42,20(36)11-34)9-16-23(19)30(41)25-24(29(16)40)27(38)14-5-3-4-6-15(14)28(25)39/h3-6,12-13,17-19,21-22,26,31,34-35,37,40-42H,7-11,33H2,1-2H3/t12-,13-,17-,18-,19-,21-,22-,26+,31+,32-/m0/s1 |
| InChIKey | VQHRZZISQVWPLK-UIRGBLDSSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| sabarubicin (CHEBI:749650) has role antineoplastic agent (CHEBI:35610) |
| sabarubicin (CHEBI:749650) is a anthracycline (CHEBI:48120) |
| INNs | Source |
|---|---|
| sabarubicin | WHO MedNet |
| sabarubicina | WHO MedNet |
| sabarubicine | WHO MedNet |
| Citations |
|---|