EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H26N6O2 |
| Net Charge | 0 |
| Average Mass | 406.490 |
| Monoisotopic Mass | 406.21172 |
| SMILES | CCCNC(=O)c1cn2ncnc(Nc3cc(C(=O)NC4CC4)ccc3C)c2c1C |
| InChI | InChI=1S/C22H26N6O2/c1-4-9-23-22(30)17-11-28-19(14(17)3)20(24-12-25-28)27-18-10-15(6-5-13(18)2)21(29)26-16-7-8-16/h5-6,10-12,16H,4,7-9H2,1-3H3,(H,23,30)(H,26,29)(H,24,25,27) |
| InChIKey | GDTQLZHHDRRBEB-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Applications: | antirheumatic drug A drug used to treat rheumatoid arthritis. antipsoriatic A drug used to treat psoriasis. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| bms-582949 (CHEBI:749646) has role antipsoriatic (CHEBI:50748) |
| bms-582949 (CHEBI:749646) has role antirheumatic drug (CHEBI:35842) |
| bms-582949 (CHEBI:749646) is a benzamides (CHEBI:22702) |
| Synonyms | Source |
|---|---|
| Bms 582949 | ChEMBL |
| Bms-582949 | ChEMBL |
| PS-540446 | ChEMBL |
| Citations |
|---|