EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H19FN2O2S |
| Net Charge | 0 |
| Average Mass | 334.416 |
| Monoisotopic Mass | 334.11513 |
| SMILES | CC(C)S(=O)(=O)N[C@H]1Cc2ccc(-c3ccc(F)nc3)cc2C1 |
| InChI | InChI=1S/C17H19FN2O2S/c1-11(2)23(21,22)20-16-8-13-4-3-12(7-15(13)9-16)14-5-6-17(18)19-10-14/h3-7,10-11,16,20H,8-9H2,1-2H3/t16-/m0/s1 |
| InChIKey | QXQSUBKWSHMXDP-INIZCTEOSA-N |
| Roles Classification |
|---|
| Application: | antipsychotic agent Antipsychotic drugs are agents that control agitated psychotic behaviour, alleviate acute psychotic states, reduce psychotic symptoms, and exert a quieting effect. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| gsk-729327 (CHEBI:749641) has role antipsychotic agent (CHEBI:35476) |
| gsk-729327 (CHEBI:749641) is a indanes (CHEBI:46940) |
| Synonyms | Source |
|---|---|
| Gsk-729327 | ChEMBL |
| Gsk729327 | ChEMBL |
| Citations |
|---|