EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H39N6O9P |
| Net Charge | 0 |
| Average Mass | 658.649 |
| Monoisotopic Mass | 658.25161 |
| SMILES | COc1nc(N)nc2c1ncn2[C@@H]1O[C@H](COP(=O)(N[C@@H](C)C(=O)OCC(C)(C)C)Oc2cccc3ccccc23)[C@@H](O)[C@@]1(C)O |
| InChI | InChI=1S/C30H39N6O9P/c1-17(26(38)42-15-29(2,3)4)35-46(40,45-20-13-9-11-18-10-7-8-12-19(18)20)43-14-21-23(37)30(5,39)27(44-21)36-16-32-22-24(36)33-28(31)34-25(22)41-6/h7-13,16-17,21,23,27,37,39H,14-15H2,1-6H3,(H,35,40)(H2,31,33,34)/t17-,21+,23+,27+,30+,46?/m0/s1 |
| InChIKey | YFXGICNMLCGLHJ-RSKRLRQZSA-N |
| Roles Classification |
|---|
| Biological Role: | antiviral agent A substance that destroys or inhibits replication of viruses. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| bms-986094 (CHEBI:749635) has role antiviral agent (CHEBI:22587) |
| bms-986094 (CHEBI:749635) is a α-amino acid ester (CHEBI:46874) |
| Synonyms | Source |
|---|---|
| BMS-986094 | ChEMBL |
| INX 08189 | ChEMBL |
| INX-08189 | ChEMBL |
| INX-089 | ChEMBL |
| INX-189 | ChEMBL |
| Citations |
|---|