EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:749631 - auriclosene
| Formula | C4H9Cl2NO3S |
| Net Charge | 0 |
| Average Mass | 222.093 |
| Monoisotopic Mass | 220.96802 |
| SMILES | CC(C)(CS(=O)(=O)O)N(Cl)Cl |
| InChI | InChI=1S/C4H9Cl2NO3S/c1-4(2,7(5)6)3-11(8,9)10/h3H2,1-2H3,(H,8,9,10) |
| InChIKey | QYNRGGHZWCUZLK-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| auriclosene (CHEBI:749631) has role antibacterial agent (CHEBI:33282) |
| auriclosene (CHEBI:749631) is a organosulfonic acid (CHEBI:33551) |
| INNs | Source |
|---|---|
| auriclosene | WHO MedNet |
| auricloseno | WHO MedNet |
| Synonyms | Source |
|---|---|
| NVC-422 | ChEMBL |
| NVC422 | ChEMBL |