EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:749630 - tetraphenylporphine tetrasulfonic acid
| Formula | C44H30N4O12S4 |
| Net Charge | 0 |
| Average Mass | 935.008 |
| Monoisotopic Mass | 934.07431 |
| SMILES | O=S(=O)(O)c1ccc(-c2c3nc(c(-c4ccc(S(=O)(=O)O)cc4)c4ccc(n4)c(-c4ccc(S(=O)(=O)O)cc4)c4ccc(n4)c(-c4ccc(S(=O)(=O)O)cc4)c4nc2C=C4)C=C3)cc1 |
| InChI | InChI=1S/C44H30N4O12S4/c49-61(50,51)29-9-1-25(2-10-29)41-33-17-19-35(45-33)42(26-3-11-30(12-4-26)62(52,53)54)37-21-23-39(47-37)44(28-7-15-32(16-8-28)64(58,59)60)40-24-22-38(48-40)43(36-20-18-34(41)46-36)27-5-13-31(14-6-27)63(55,56)57/h1-24,45-46H,(H,49,50,51)(H,52,53,54)(H,55,56,57)(H,58,59,60)/b41-33-,41-34-,42-35-,42-37-,43-36-,43-38-,44-39-,44-40- |
| InChIKey | YAVMDSYMZGJNES-LWQDQPMZSA-N |
| Roles Classification |
|---|
| Biological Role: | antiviral agent A substance that destroys or inhibits replication of viruses. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tetraphenylporphine tetrasulfonic acid (CHEBI:749630) has role antiviral agent (CHEBI:22587) |
| tetraphenylporphine tetrasulfonic acid (CHEBI:749630) is a metallotetrapyrrole (CHEBI:33909) |
| Synonyms | Source |
|---|---|
| NSC-322091 | ChEMBL |
| Tetraphenylporphine tetrasulfonic acid | ChEMBL |
| Citations |
|---|