EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H23O10PS |
| Net Charge | 0 |
| Average Mass | 474.424 |
| Monoisotopic Mass | 474.07495 |
| SMILES | COc1cc(OC)c(/C=C/S(=O)(=O)Cc2ccc(OC)c(OP(=O)(O)O)c2)c(OC)c1 |
| InChI | InChI=1S/C19H23O10PS/c1-25-14-10-17(27-3)15(18(11-14)28-4)7-8-31(23,24)12-13-5-6-16(26-2)19(9-13)29-30(20,21)22/h5-11H,12H2,1-4H3,(H2,20,21,22)/b8-7+ |
| InChIKey | LXENKEWVEVKKGV-BQYQJAHWSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| briciclib (CHEBI:749626) has role antineoplastic agent (CHEBI:35610) |
| briciclib (CHEBI:749626) is a aryl phosphate (CHEBI:36943) |
| INN | Source |
|---|---|
| briciclib | WHO MedNet |
| Synonyms | Source |
|---|---|
| On-013105 | ChEMBL |
| ON 014185 | ChEMBL |
| ON-014185 | ChEMBL |
| ON014185 | ChEMBL |