EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H22O12P2 |
| Net Charge | 0 |
| Average Mass | 492.310 |
| Monoisotopic Mass | 492.05865 |
| SMILES | COc1cc(/C=C\c2ccc(OC)c(OP(=O)(O)O)c2OP(=O)(O)O)cc(OC)c1OC |
| InChI | InChI=1S/C18H22O12P2/c1-25-13-8-7-12(16(29-31(19,20)21)18(13)30-32(22,23)24)6-5-11-9-14(26-2)17(28-4)15(10-11)27-3/h5-10H,1-4H3,(H2,19,20,21)(H2,22,23,24)/b6-5- |
| InChIKey | GSOXMQLWUDQTNT-WAYWQWQTSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| oxi-4503 (CHEBI:749621) has role antineoplastic agent (CHEBI:35610) |
| oxi-4503 (CHEBI:749621) is a stilbenoid (CHEBI:26776) |
| Synonyms | Source |
|---|---|
| Combretastatin a-1 bis(phosphate) | ChEMBL |
| Combretastatin a1 diphosphate | ChEMBL |
| Combretastatin a-1 phosphate | ChEMBL |
| Oxi-4503 | ChEMBL |