EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | HCl.C11H21NO3 |
| Net Charge | 0 |
| Average Mass | 251.754 |
| Monoisotopic Mass | 251.12882 |
| SMILES | CCCCCCOC(=O)CCC(=O)CN.Cl |
| InChI | InChI=1S/C11H21NO3.ClH/c1-2-3-4-5-8-15-11(14)7-6-10(13)9-12;/h2-9,12H2,1H3;1H |
| InChIKey | LZYXPFZBAZTOCH-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| hexaminolevulinate hydrochloride (CHEBI:749596) has functional parent δ-amino acid (CHEBI:35931) |
| hexaminolevulinate hydrochloride (CHEBI:749596) has role antineoplastic agent (CHEBI:35610) |
| hexaminolevulinate hydrochloride (CHEBI:749596) is a organonitrogen compound (CHEBI:35352) |
| hexaminolevulinate hydrochloride (CHEBI:749596) is a organooxygen compound (CHEBI:36963) |
| Synonyms | Source |
|---|---|
| Cysview | ChEMBL |
| Hexaminolevulinate hcl | ChEMBL |
| Hexyl aminolevulinate hcl | ChEMBL |
| P-1026 | ChEMBL |
| P-1206 | ChEMBL |
| Brand Name | Source |
|---|---|
| Cysview kit | ChEMBL |