EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | HCl.C19H21ClFN3O3 |
| Net Charge | 0 |
| Average Mass | 430.307 |
| Monoisotopic Mass | 429.10223 |
| SMILES | Cl.N[C@@H]1CCCCN(c2c(F)cc3c(=O)c(C(=O)O)cn(C4CC4)c3c2Cl)C1 |
| InChI | InChI=1S/C19H21ClFN3O3.ClH/c20-15-16-12(18(25)13(19(26)27)9-24(16)11-4-5-11)7-14(21)17(15)23-6-2-1-3-10(22)8-23;/h7,9-11H,1-6,8,22H2,(H,26,27);1H/t10-;/m1./s1 |
| InChIKey | PMQBICKXAAKXAY-HNCPQSOCSA-N |
| Roles Classification |
|---|
| Biological Role: | antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. |
| Applications: | ophthalmology drug Any compound used for the treatment of eye conditions or eye diseases. anti-ulcer drug One of various classes of drugs with different action mechanisms used to treat or ameliorate peptic ulcer or irritation of the gastrointestinal tract. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| besifloxacin hydrochloride (CHEBI:749592) has role anti-ulcer drug (CHEBI:49201) |
| besifloxacin hydrochloride (CHEBI:749592) has role antibacterial agent (CHEBI:33282) |
| besifloxacin hydrochloride (CHEBI:749592) has role ophthalmology drug (CHEBI:66981) |
| besifloxacin hydrochloride (CHEBI:749592) is a organic molecular entity (CHEBI:50860) |
| besifloxacin hydrochloride (CHEBI:749592) is a quinolines (CHEBI:26513) |
| Synonyms | Source |
|---|---|
| Besifloxacin (as hydrochloride) | ChEMBL |
| SS-734 | ChEMBL |