EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | HCl.C19H21ClFN3O3 |
| Net Charge | 0 |
| Average Mass | 430.307 |
| Monoisotopic Mass | 429.10223 |
| SMILES | Cl.N[C@@H]1CCCCN(c2c(F)cc3c(=O)c(C(=O)O)cn(C4CC4)c3c2Cl)C1 |
| InChI | InChI=1S/C19H21ClFN3O3.ClH/c20-15-16-12(18(25)13(19(26)27)9-24(16)11-4-5-11)7-14(21)17(15)23-6-2-1-3-10(22)8-23;/h7,9-11H,1-6,8,22H2,(H,26,27);1H/t10-;/m1./s1 |
| InChIKey | PMQBICKXAAKXAY-HNCPQSOCSA-N |
| Roles Classification |
|---|
| Biological Role: | antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. |
| Applications: | anti-ulcer drug One of various classes of drugs with different action mechanisms used to treat or ameliorate peptic ulcer or irritation of the gastrointestinal tract. ophthalmology drug Any compound used for the treatment of eye conditions or eye diseases. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| besifloxacin hydrochloride (CHEBI:749592) has role anti-ulcer drug (CHEBI:49201) |
| besifloxacin hydrochloride (CHEBI:749592) has role antibacterial agent (CHEBI:33282) |
| besifloxacin hydrochloride (CHEBI:749592) has role ophthalmology drug (CHEBI:66981) |
| besifloxacin hydrochloride (CHEBI:749592) is a quinolines (CHEBI:26513) |
| Synonyms | Source |
|---|---|
| Besifloxacin (as hydrochloride) | ChEMBL |
| SS-734 | ChEMBL |