EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | H2O.C28H22F3N7O.HCl |
| Net Charge | 0 |
| Average Mass | 584.002 |
| Monoisotopic Mass | 583.17104 |
| SMILES | Cc1cn(-c2cc(NC(=O)c3ccc(C)c(Nc4nccc(-c5cccnc5)n4)c3)cc(C(F)(F)F)c2)cn1.Cl.O |
| InChI | InChI=1S/C28H22F3N7O.ClH.H2O/c1-17-5-6-19(10-25(17)37-27-33-9-7-24(36-27)20-4-3-8-32-14-20)26(39)35-22-11-21(28(29,30)31)12-23(13-22)38-15-18(2)34-16-38;;/h3-16H,1-2H3,(H,35,39)(H,33,36,37);1H;1H2 |
| InChIKey | YCBPQSYLYYBPDW-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Applications: | antiparkinson drug A drug used in the treatment of Parkinson's disease. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| nilotinib hydrochloride monohydrate (CHEBI:749589) has role antineoplastic agent (CHEBI:35610) |
| nilotinib hydrochloride monohydrate (CHEBI:749589) has role antiparkinson drug (CHEBI:48407) |
| nilotinib hydrochloride monohydrate (CHEBI:749589) is a benzamides (CHEBI:22702) |
| Synonyms | Source |
|---|---|
| Nilotinib (as hydrochloride) | ChEMBL |
| Nilotinib hydrochloride | ChEMBL |
| Nilotinib hydrochloride anhydrous | ChEMBL |
| Nilotinib hydrochloride hydrate | ChEMBL |
| Nilotinib hydrochloride monohydrate | ChEMBL |