EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | HCl.C31H44N2O5S |
| Net Charge | 0 |
| Average Mass | 593.230 |
| Monoisotopic Mass | 592.27377 |
| SMILES | CCCCc1oc2ccc(NS(C)(=O)=O)cc2c1C(=O)c1ccc(OCCCN(CCCC)CCCC)cc1.Cl |
| InChI | InChI=1S/C31H44N2O5S.ClH/c1-5-8-12-29-30(27-23-25(32-39(4,35)36)15-18-28(27)38-29)31(34)24-13-16-26(17-14-24)37-22-11-21-33(19-9-6-2)20-10-7-3;/h13-18,23,32H,5-12,19-22H2,1-4H3;1H |
| InChIKey | DWKVCQXJYURSIQ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | anti-arrhythmia drug A drug used for the treatment or prevention of cardiac arrhythmias. Anti-arrhythmia drugs may affect the polarisation-repolarisation phase of the action potential, its excitability or refractoriness, or impulse conduction or membrane responsiveness within cardiac fibres. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dronedarone hydrochloride (CHEBI:749586) has role anti-arrhythmia drug (CHEBI:38070) |
| dronedarone hydrochloride (CHEBI:749586) is a aromatic ketone (CHEBI:76224) |
| Synonym | Source |
|---|---|
| SR-33598B | ChEMBL |
| Citations |
|---|