EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H14N5O8P |
| Net Charge | 0 |
| Average Mass | 363.223 |
| Monoisotopic Mass | 363.05800 |
| SMILES | Nc1nc(=O)c2ncn([C@@H]3O[C@H](CO)[C@@H](O)[C@H]3OP(=O)(O)O)c2n1 |
| InChI | InChI=1S/C10H14N5O8P/c11-10-13-7-4(8(18)14-10)12-2-15(7)9-6(23-24(19,20)21)5(17)3(1-16)22-9/h2-3,5-6,9,16-17H,1H2,(H2,19,20,21)(H3,11,13,14,18)/t3-,5-,6-,9-/m1/s1 |
| InChIKey | WTIFIAZWCCBCGE-UUOKFMHZSA-N |
| Roles Classification |
|---|
| Biological Role: | EC 3.1.27.3 (ribonuclease T1) inhibitor An EC 3.1.27.* (endoribonucleases producing other than 5'-phosphomonoesters) inhibitor that interferes with the action of ribonuclease T1 (EC 3.1.27.3). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| guanosine 2'-monophosphate (CHEBI:74948) has role EC 3.1.27.3 (ribonuclease T1) inhibitor (CHEBI:74949) |
| guanosine 2'-monophosphate (CHEBI:74948) is a purine ribonucleoside 2'-monophosphate (CHEBI:37649) |
| guanosine 2'-monophosphate (CHEBI:74948) is conjugate acid of guanosine 2'-monophosphate(2−) (CHEBI:74604) |
| Incoming Relation(s) |
| guanosine 2'-monophosphate(2−) (CHEBI:74604) is conjugate base of guanosine 2'-monophosphate (CHEBI:74948) |
| IUPAC Name |
|---|
| 2'-guanylic acid |
| Synonyms | Source |
|---|---|
| guanosine 2'-phosphate | ChEBI |
| 2'-GMP | ChemIDplus |
| 2'-O-phosphoguanosine | ChEBI |
| Citations |
|---|