EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
We are looking for a new Chemistry curator to join the ChEBI team. Find out more about it here.
CHEBI:749423 - moexiprilat
| Formula | C25H30N2O7 |
| Net Charge | 0 |
| Average Mass | 470.522 |
| Monoisotopic Mass | 470.20530 |
| SMILES | COc1cc2c(cc1OC)CN(C(=O)[C@H](C)N[C@@H](CCc1ccccc1)C(=O)O)[C@H](C(=O)O)C2 |
| InChI | InChI=1S/C25H30N2O7/c1-15(26-19(24(29)30)10-9-16-7-5-4-6-8-16)23(28)27-14-18-13-22(34-3)21(33-2)12-17(18)11-20(27)25(31)32/h4-8,12-13,15,19-20,26H,9-11,14H2,1-3H3,(H,29,30)(H,31,32)/t15-,19-,20-/m0/s1 |
| InChIKey | CMPAGYDKASJORH-YSSFQJQWSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| moexiprilat (CHEBI:749423) is a dipeptide (CHEBI:46761) |
| INNs | Source |
|---|---|
| moexiprilat | WHO MedNet |
| moexiprilate | WHO MedNet |
| Synonyms | Source |
|---|---|
| Moexipril related compound a | ChEMBL |
| RS-10029 | ChEMBL |
| Citations |
|---|