EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H16ClNO4S |
| Net Charge | 0 |
| Average Mass | 341.816 |
| Monoisotopic Mass | 341.04886 |
| SMILES | O=C(O)/C=C1\CN([C@H](C(=O)O)c2ccccc2Cl)CCC1S |
| InChI | InChI=1S/C15H16ClNO4S/c16-11-4-2-1-3-10(11)14(15(20)21)17-6-5-12(22)9(8-17)7-13(18)19/h1-4,7,12,14,22H,5-6,8H2,(H,18,19)(H,20,21)/b9-7+/t12?,14-/m0/s1 |
| InChIKey | GZZDPOCSWMTUJU-ODAXIEOESA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| clopidogrel metabolite h4 (CHEBI:749421) is a α-amino acid (CHEBI:33704) |
| Synonyms | Source |
|---|---|
| 2-oxoclopidogrel | ChEMBL |
| Clopidogrel metabolite h4 | ChEMBL |