EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | HCl.C21H25ClN2O3.HCl |
| Net Charge | 0 |
| Average Mass | 461.817 |
| Monoisotopic Mass | 460.10873 |
| SMILES | Cl.Cl.O=C(O)COCCN1CCN([C@H](c2ccccc2)c2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C21H25ClN2O3.2ClH/c22-19-8-6-18(7-9-19)21(17-4-2-1-3-5-17)24-12-10-23(11-13-24)14-15-27-16-20(25)26;;/h1-9,21H,10-16H2,(H,25,26);2*1H/t21-;;/m1../s1 |
| InChIKey | PGLIUCLTXOYQMV-GHVWMZMZSA-N |
| Roles Classification |
|---|
| Applications: | antitussive An agent that suppresses cough. Antitussives have a central or a peripheral action on the cough reflex, or a combination of both. Compare with expectorants, which are considered to increase the volume of secretions in the respiratory tract, so facilitating their removal by ciliary action and coughing, and mucolytics, which decrease the viscosity of mucus, facilitating its removal by ciliary action and expectoration. anti-allergic agent A drug used to treat allergic reactions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| levocetirizine dihydrochloride (CHEBI:749394) has role anti-allergic agent (CHEBI:50857) |
| levocetirizine dihydrochloride (CHEBI:749394) has role antitussive (CHEBI:51177) |
| levocetirizine dihydrochloride (CHEBI:749394) is a diarylmethane (CHEBI:51614) |
| Synonyms | Source |
|---|---|
| Cetirizine hydrochloride (r)- | ChEMBL |
| Cetirizine (r)-form dihydrochloride | ChEMBL |
| Levocetirizine monohydrochloride | ChEMBL |
| NSC-758898 | ChEMBL |
| UCB 28556 | ChEMBL |
| UCB-28556 | ChEMBL |
| Brand Names | Source |
|---|---|
| Xusal | ChEMBL |
| Xyzal allergy 24hr | ChEMBL |
| Xyzall | ChEMBL |
| Citations |
|---|