EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:749390 - lisdexamfetamine dimesylate
| Formula | CH4O3S.C15H25N3O.CH4O3S |
| Net Charge | 0 |
| Average Mass | 455.599 |
| Monoisotopic Mass | 455.17599 |
| SMILES | CS(=O)(=O)O.CS(=O)(=O)O.C[C@@H](Cc1ccccc1)NC(=O)[C@@H](N)CCCCN |
| InChI | InChI=1S/C15H25N3O.2CH4O3S/c1-12(11-13-7-3-2-4-8-13)18-15(19)14(17)9-5-6-10-16;2*1-5(2,3)4/h2-4,7-8,12,14H,5-6,9-11,16-17H2,1H3,(H,18,19);2*1H3,(H,2,3,4)/t12-,14-;;/m0../s1 |
| InChIKey | CETWSOHVEGTIBR-FORAGAHYSA-N |
| Roles Classification |
|---|
| Biological Role: | anti-obesity agent Any substance which is used to reduce or control weight. |
| Applications: | antipsychotic agent Antipsychotic drugs are agents that control agitated psychotic behaviour, alleviate acute psychotic states, reduce psychotic symptoms, and exert a quieting effect. antiglaucoma drug Any drug which can be used to prevent or alleviate glaucoma, a disease in which the optic nerve is damaged, resulting in progressive, irreversible loss of vision. It is often, though not always, associated with increased pressure of the fluid in the eye. antidepressant Antidepressants are mood-stimulating drugs used primarily in the treatment of affective disorders and related conditions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| lisdexamfetamine dimesylate (CHEBI:749390) has role anti-obesity agent (CHEBI:74518) |
| lisdexamfetamine dimesylate (CHEBI:749390) has role antidepressant (CHEBI:35469) |
| lisdexamfetamine dimesylate (CHEBI:749390) has role antiglaucoma drug (CHEBI:39456) |
| lisdexamfetamine dimesylate (CHEBI:749390) has role antipsychotic agent (CHEBI:35476) |
| lisdexamfetamine dimesylate (CHEBI:749390) is a amino acid amide (CHEBI:22475) |
| Synonyms | Source |
|---|---|
| Lisdexamfetamine dimesilate | ChEMBL |
| Lisdexamfetamine dimethanesulfonate | ChEMBL |
| Lisdexamfetamine mesilate | ChEMBL |
| Lisdexamphetamine dimesilate | ChEMBL |
| NRP-104 | ChEMBL |
| NRP104 | ChEMBL |
| Brand Names | Source |
|---|---|
| Elvanse | ChEMBL |
| Elvanse adult | ChEMBL |