EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
We are looking for a new Chemistry curator to join the ChEBI team. Find out more about it here.
CHEBI:749388 - iodamide meglumine
| Formula | C7H17NO5.C12H11I3N2O4 |
| Net Charge | 0 |
| Average Mass | 823.157 |
| Monoisotopic Mass | 822.89597 |
| SMILES | CC(=O)NCc1c(I)c(NC(C)=O)c(I)c(C(=O)O)c1I.CNC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C12H11I3N2O4.C7H17NO5/c1-4(18)16-3-6-8(13)7(12(20)21)10(15)11(9(6)14)17-5(2)19;1-8-2-4(10)6(12)7(13)5(11)3-9/h3H2,1-2H3,(H,16,18)(H,17,19)(H,20,21);4-13H,2-3H2,1H3/t;4-,5+,6+,7+/m.0/s1 |
| InChIKey | UYIPQECISAQMIU-WZTVWXICSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| iodamide meglumine (CHEBI:749388) is a amidobenzoic acid (CHEBI:48470) |
| Synonyms | Source |
|---|---|
| Iodamide n-methyl-d-glucamine salt | ChEMBL |
| Meglumine iodamide injection | ChEMBL |
| Meglumine sodium iodamide injection | ChEMBL |
| Brand Names | Source |
|---|---|
| Renovue | ChEMBL |
| Renovue-65 | ChEMBL |
| Renovue-dip | ChEMBL |