EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | CH4O3S.C12H13N |
| Net Charge | 0 |
| Average Mass | 267.350 |
| Monoisotopic Mass | 267.09291 |
| SMILES | C#CCN[C@@H]1CCc2ccccc21.CS(=O)(=O)O |
| InChI | InChI=1S/C12H13N.CH4O3S/c1-2-9-13-12-8-7-10-5-3-4-6-11(10)12;1-5(2,3)4/h1,3-6,12-13H,7-9H2;1H3,(H,2,3,4)/t12-;/m1./s1 |
| InChIKey | JDBJJCWRXSVHOQ-UTONKHPSSA-N |
| Roles Classification |
|---|
| Application: | antiparkinson drug A drug used in the treatment of Parkinson's disease. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| rasagiline mesylate (CHEBI:749383) has role antiparkinson drug (CHEBI:48407) |
| rasagiline mesylate (CHEBI:749383) is a indanes (CHEBI:46940) |
| Synonyms | Source |
|---|---|
| Agilect | ChEMBL |
| Rasagiline (as mesilate) | ChEMBL |
| Rasagline ratiopharm | ChEMBL |
| TVP-1012 | ChEMBL |
| Brand Name | Source |
|---|---|
| Rasagiline ratiopharm | ChEMBL |
| Citations |
|---|