EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H12N4O4 |
| Net Charge | 0 |
| Average Mass | 228.208 |
| Monoisotopic Mass | 228.08585 |
| SMILES | [H][C@]1(n2cnc(N)nc2=O)C[C@H](O)[C@@H](CO)O1 |
| InChI | InChI=1S/C8H12N4O4/c9-7-10-3-12(8(15)11-7)6-1-4(14)5(2-13)16-6/h3-6,13-14H,1-2H2,(H2,9,11,15)/t4-,5+,6+/m0/s1 |
| InChIKey | XAUDJQYHKZQPEU-KVQBGUIXSA-N |
| Roles Classification |
|---|
| Biological Roles: | anti-HIV agent An antiviral agent that destroys or inhibits the replication of the human immunodeficiency virus. antiviral agent A substance that destroys or inhibits replication of viruses. |
| Applications: | anti-anaemic agent A compound which increases either the number of red cells or the amount of haemoglobin in the blood. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. antifibrotic agent Any agent which acts to reduce fibrosis. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| decitabine (CHEBI:749378) has role anti-anaemic agent (CHEBI:75835) |
| decitabine (CHEBI:749378) has role anti-HIV agent (CHEBI:64946) |
| decitabine (CHEBI:749378) has role antifibrotic agent (CHEBI:233423) |
| decitabine (CHEBI:749378) has role antineoplastic agent (CHEBI:35610) |
| decitabine (CHEBI:749378) has role antiviral agent (CHEBI:22587) |
| decitabine (CHEBI:749378) is a triazines (CHEBI:38102) |
| INN | Source |
|---|---|
| decitabina | WHO MedNet |
| Synonyms | Source |
|---|---|
| 2'-deoxy-5-azacytidine | ChEMBL |
| DAC | ChEMBL |
| NSC-127716 | ChEMBL |
| Brand Names | Source |
|---|---|
| Decitabine component of astx-727 | ChEMBL |
| Decitabine component of astx727 | ChEMBL |
| Decitabine component of inqovi | ChEMBL |
| Citations |
|---|