EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | H3O4P.C22H24N2O8 |
| Net Charge | 0 |
| Average Mass | 542.434 |
| Monoisotopic Mass | 542.13016 |
| SMILES | O=P(O)(O)O.[H][C@]12C[C@@]3([H])[C@H](N(C)C)C(O)=C(C(N)=O)C(=O)[C@@]3(O)C(O)=C1C(=O)c1c(O)cccc1[C@@]2(C)O |
| InChI | InChI=1S/C22H24N2O8.H3O4P/c1-21(31)8-5-4-6-11(25)12(8)16(26)13-9(21)7-10-15(24(2)3)17(27)14(20(23)30)19(29)22(10,32)18(13)28;1-5(2,3)4/h4-6,9-10,15,25,27-28,31-32H,7H2,1-3H3,(H2,23,30);(H3,1,2,3,4)/t9-,10-,15-,21+,22-;/m0./s1 |
| InChIKey | WXDJNRXQVCECPF-FMZCEJRJSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tetracycline phosphate complex (CHEBI:749367) is a tetracyclines (CHEBI:26895) |
| Synonym | Source |
|---|---|
| Tetracycline hexametaphosphate | ChEMBL |
| Brand Name | Source |
|---|---|
| Tetrex | ChEMBL |