EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
We are looking for a new Chemistry curator to join the ChEBI team. Find out more about it here.
CHEBI:749365 - levalbuterol hydrochloride
| Formula | HCl.C13H21NO3 |
| Net Charge | 0 |
| Average Mass | 275.776 |
| Monoisotopic Mass | 275.12882 |
| SMILES | CC(C)(C)NC[C@H](O)c1ccc(O)c(CO)c1.Cl |
| InChI | InChI=1S/C13H21NO3.ClH/c1-13(2,3)14-7-12(17)9-4-5-11(16)10(6-9)8-15;/h4-6,12,14-17H,7-8H2,1-3H3;1H/t12-;/m0./s1 |
| InChIKey | OWNWYCOLFIFTLK-YDALLXLXSA-N |
| Roles Classification |
|---|
| Application: | antispasmodic drug A drug that suppresses spasms. These are usually caused by smooth muscle contraction, especially in tubular organs. The effect is to prevent spasms of the stomach, intestine or urinary bladder. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| levalbuterol hydrochloride (CHEBI:749365) has role antispasmodic drug (CHEBI:53784) |
| levalbuterol hydrochloride (CHEBI:749365) is a benzyl alcohols (CHEBI:22743) |
| Synonyms | Source |
|---|---|
| Albuterol hydrochloride, r- | ChEMBL |
| Albuterol (r)-form hydrochloride | ChEMBL |
| Levosalbutamol hydrochloride | ChEMBL |
| NSC-759255 | ChEMBL |
| Citations |
|---|