EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
We are looking for a new Chemistry curator to join the ChEBI team. Find out more about it here.
CHEBI:749361 - anileridine hydrochloride
| Formula | HCl.C22H28N2O2 |
| Net Charge | 0 |
| Average Mass | 388.939 |
| Monoisotopic Mass | 388.19176 |
| SMILES | CCOC(=O)C1(c2ccccc2)CCN(CCc2ccc(N)cc2)CC1.Cl |
| InChI | InChI=1S/C22H28N2O2.ClH/c1-2-26-21(25)22(19-6-4-3-5-7-19)13-16-24(17-14-22)15-12-18-8-10-20(23)11-9-18;/h3-11H,2,12-17,23H2,1H3;1H |
| InChIKey | UDUQHZSAAWGSPJ-UHFFFAOYSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| anileridine hydrochloride (CHEBI:749361) is a piperidines (CHEBI:26151) |
| Synonyms | Source |
|---|---|
| Aldine | ChEMBL |
| Anileridine hydrochloride cii | ChEMBL |
| Apodol | ChEMBL |
| Leritine dihydrochloride | ChEMBL |
| Citations |
|---|