EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C39H69O8P |
| Net Charge | 0 |
| Average Mass | 696.947 |
| Monoisotopic Mass | 696.47301 |
| SMILES | CCCCC/C=C\C/C=C\C/C=C\CCCCC(=O)OC[C@H](COP(=O)(O)O)OC(=O)CCCCCCC/C=C\CCCCCCCC |
| InChI | InChI=1S/C39H69O8P/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-38(40)45-35-37(36-46-48(42,43)44)47-39(41)34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-4-2/h11,13,17-20,23,25,37H,3-10,12,14-16,21-22,24,26-36H2,1-2H3,(H2,42,43,44)/b13-11-,19-17-,20-18-,25-23-/t37-/m1/s1 |
| InChIKey | PMILXINPEBVJKS-FCFBPKLPSA-N |
| Roles Classification |
|---|
| Chemical Roles: | antioxidant A substance that opposes oxidation or inhibits reactions brought about by dioxygen or peroxides. solvent A liquid that can dissolve other substances (solutes) without any change in their chemical composition. Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | Escherichia coli metabolite Any bacterial metabolite produced during a metabolic reaction in Escherichia coli. mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). Daphnia galeata metabolite A Daphnia metabolite produced by the species Daphnia galeata. EC 3.1.1.1 (carboxylesterase) inhibitor Any EC 3.1.1.* (carboxylic ester hydrolase) inhibitor that inhibits the action of carboxylesterase (EC 3.1.1.1 ). plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. Escherichia coli metabolite Any bacterial metabolite produced during a metabolic reaction in Escherichia coli. |
| Application: | solvent A liquid that can dissolve other substances (solutes) without any change in their chemical composition. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1-(γ-linolenoyl)-2-oleoyl-sn-glycero-3-phosphate (CHEBI:74936) has functional parent γ-linolenic acid (CHEBI:28661) |
| 1-(γ-linolenoyl)-2-oleoyl-sn-glycero-3-phosphate (CHEBI:74936) is a 1,2-diacyl-sn-glycerol 3-phosphate (CHEBI:29089) |
| 1-(γ-linolenoyl)-2-oleoyl-sn-glycero-3-phosphate (CHEBI:74936) is a oleic acid (CHEBI:16196) |
| 1-(γ-linolenoyl)-2-oleoyl-sn-glycero-3-phosphate (CHEBI:74936) is conjugate acid of 1-(γ-linolenoyl)-2-oleoyl-sn-glycero-3-phosphate(2−) (CHEBI:74582) |
| Incoming Relation(s) |
| 1-(γ-linolenoyl)-2-oleoyl-sn-glycero-3-phosphate(2−) (CHEBI:74582) is conjugate base of 1-(γ-linolenoyl)-2-oleoyl-sn-glycero-3-phosphate (CHEBI:74936) |
| IUPAC Name |
|---|
| (2R)-2-[(9Z)-octadec-9-enoyloxy]-3-(phosphonooxy)propyl (6Z,9Z,12Z)-octadecatrienoyl-2-(9Z)-octadeca-6,9,12-trienoate |
| Synonyms | Source |
|---|---|
| 1-(6Z,9Z,12Z-octadecatrienoyl)-2-(9Z-octadecenoyl)-glycero-3-phosphate | LIPID MAPS |
| (6Z,9Z,12Z)-octadecatrienoyl-2-(9Z)-octadecenoyl-sn-glycero-3-phosphate | ChEBI |
| PA(18:3(6Z,9Z,12Z)/18:1(9Z)) | LIPID MAPS |
| Manual Xrefs | Databases |
|---|---|
| LMGP10010376 | LIPID MAPS |