EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
We are looking for a new Chemistry curator to join the ChEBI team. Find out more about it here.
CHEBI:749355 - pyrilamine maleate
| Formula | C4H4O4.C17H23N3O |
| Net Charge | 0 |
| Average Mass | 401.463 |
| Monoisotopic Mass | 401.19507 |
| SMILES | COc1ccc(CN(CCN(C)C)c2ccccn2)cc1.O=C(O)/C=C\C(=O)O |
| InChI | InChI=1S/C17H23N3O.C4H4O4/c1-19(2)12-13-20(17-6-4-5-11-18-17)14-15-7-9-16(21-3)10-8-15;5-3(6)1-2-4(7)8/h4-11H,12-14H2,1-3H3;1-2H,(H,5,6)(H,7,8)/b;2-1- |
| InChIKey | JXYWFNAQESKDNC-BTJKTKAUSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pyrilamine maleate (CHEBI:749355) is a aminopyridine (CHEBI:38207) |
| Synonyms | Source |
|---|---|
| Antamine | ChEMBL |
| Anthisan | ChEMBL |
| Dorantamin | ChEMBL |
| Enrumay | ChEMBL |
| Histalon | ChEMBL |
| Histan | ChEMBL |
| Brand Name | Source |
|---|---|
| Pyrilamine maleate component of prefrin-a | ChEMBL |
| Citations |
|---|