EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H8N2O2S |
| Net Charge | 0 |
| Average Mass | 232.264 |
| Monoisotopic Mass | 232.03065 |
| SMILES | COC(=O)/C(C#N)=C1\Nc2ccccc2S1 |
| InChI | InChI=1S/C11H8N2O2S/c1-15-11(14)7(6-12)10-13-8-4-2-3-5-9(8)16-10/h2-5,13H,1H3/b10-7+ |
| InChIKey | SEIUOPPGQAMYGB-JXMROGBWSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| methyl (2E)-1,3-benzothiazol-2(3H)-ylidene(cyano)acetate (CHEBI:74935) has functional parent methyl cyanoacetate (CHEBI:51928) |
| methyl (2E)-1,3-benzothiazol-2(3H)-ylidene(cyano)acetate (CHEBI:74935) has role metabolite (CHEBI:25212) |
| methyl (2E)-1,3-benzothiazol-2(3H)-ylidene(cyano)acetate (CHEBI:74935) is a benzothiazoles (CHEBI:37947) |
| methyl (2E)-1,3-benzothiazol-2(3H)-ylidene(cyano)acetate (CHEBI:74935) is a methyl ester (CHEBI:25248) |
| methyl (2E)-1,3-benzothiazol-2(3H)-ylidene(cyano)acetate (CHEBI:74935) is a nitrile (CHEBI:18379) |
| IUPAC Name |
|---|
| methyl (2E)-1,3-benzothiazol-2(3H)-ylidene(cyano)acetate |
| Synonyms | Source |
|---|---|
| AC1NRZ8N | ChEBI |
| methyl (2E)-2-(3H-1,3-benzothiazol-2-ylidene)-2-cyanoacetate | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:3552564 | Reaxys |