EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | H2O.C16H18N2O4S.C13H20N2O2 |
| Net Charge | 0 |
| Average Mass | 588.727 |
| Monoisotopic Mass | 588.26177 |
| SMILES | CCN(CC)CCOC(=O)c1ccc(N)cc1.O.[H][C@]12SC(C)(C)[C@H](C(=O)O)N1C(=O)[C@H]2NC(=O)Cc1ccccc1 |
| InChI | InChI=1S/C16H18N2O4S.C13H20N2O2.H2O/c1-16(2)12(15(21)22)18-13(20)11(14(18)23-16)17-10(19)8-9-6-4-3-5-7-9;1-3-15(4-2)9-10-17-13(16)11-5-7-12(14)8-6-11;/h3-7,11-12,14H,8H2,1-2H3,(H,17,19)(H,21,22);5-8H,3-4,9-10,14H2,1-2H3;1H2/t11-,12+,14-;;/m1../s1 |
| InChIKey | KZDCMKVLEYCGQX-UDPGNSCCSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. |
| Application: | antiinfective agent A substance used in the prophylaxis or therapy of infectious diseases. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| penicillin g procaine (CHEBI:749343) has role antibacterial agent (CHEBI:33282) |
| penicillin g procaine (CHEBI:749343) has role antiinfective agent (CHEBI:35441) |
| penicillin g procaine (CHEBI:749343) is a peptide (CHEBI:16670) |
| Synonyms | Source |
|---|---|
| Benzylpenicillin procaine | ChEMBL |
| Crysticillin a.s. | ChEMBL |
| Procaine penicillin | ChEMBL |
| Procaine penicillin g | ChEMBL |
| Procaine penicillin g monohydrate | ChEMBL |
| Procaini benzylpenicillinum | ChEMBL |
| Brand Names | Source |
|---|---|
| Duracillin a.s. | ChEMBL |
| Pfizerpen-as | ChEMBL |