EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:749332 - phentolamine mesylate
| Formula | C17H19N3O.CH4O3S |
| Net Charge | 0 |
| Average Mass | 377.466 |
| Monoisotopic Mass | 377.14093 |
| SMILES | CS(=O)(=O)O.Cc1ccc(N(CC2=NCCN2)c2cccc(O)c2)cc1 |
| InChI | InChI=1S/C17H19N3O.CH4O3S/c1-13-5-7-14(8-6-13)20(12-17-18-9-10-19-17)15-3-2-4-16(21)11-15;1-5(2,3)4/h2-8,11,21H,9-10,12H2,1H3,(H,18,19);1H3,(H,2,3,4) |
| InChIKey | OGIYDFVHFQEFKQ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Applications: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. cardiovascular drug A drug that affects the rate or intensity of cardiac contraction, blood vessel diameter or blood volume. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| phentolamine mesylate (CHEBI:749332) has role antineoplastic agent (CHEBI:35610) |
| phentolamine mesylate (CHEBI:749332) has role cardiovascular drug (CHEBI:35554) |
| phentolamine mesylate (CHEBI:749332) is a aromatic amine (CHEBI:33860) |
| phentolamine mesylate (CHEBI:749332) is a tertiary amino compound (CHEBI:50996) |
| Synonyms | Source |
|---|---|
| Mesylate phentolamine | ChEMBL |
| NV-101 | ChEMBL |
| Phentolamine methanesulfonate | ChEMBL |
| Ryzumvi | ChEMBL |
| Brand Name | Source |
|---|---|
| Oraverse | ChEMBL |
| Citations |
|---|