EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | Na.C27H31N2O6S2 |
| Net Charge | 0 |
| Average Mass | 566.677 |
| Monoisotopic Mass | 566.15212 |
| SMILES | CCN(CC)c1ccc(C(=C2C=CC(=[N+](CC)CC)C=C2)c2cc(S(=O)(=O)[O-])ccc2S(=O)(=O)[O-])cc1.[Na+] |
| InChI | InChI=1S/C27H32N2O6S2.Na/c1-5-28(6-2)22-13-9-20(10-14-22)27(21-11-15-23(16-12-21)29(7-3)8-4)25-19-24(36(30,31)32)17-18-26(25)37(33,34)35;/h9-19H,5-8H2,1-4H3,(H-,30,31,32,33,34,35);/q;+1/p-1 |
| InChIKey | NLUFDZBOHMOBOE-UHFFFAOYSA-M |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| isosulfan blue (CHEBI:749330) has role antineoplastic agent (CHEBI:35610) |
| isosulfan blue (CHEBI:749330) is a diarylmethane (CHEBI:51614) |
| Synonyms | Source |
|---|---|
| Acid blue 1 | ChEMBL |
| Acid blue v | ChEMBL |
| C.i. 42045 | ChEMBL |
| Ci 42045 | ChEMBL |
| C.i. acid blue 1 | ChEMBL |
| C.i. food blue 3 | ChEMBL |
| Brand Name | Source |
|---|---|
| Lymphazurin | ChEMBL |