EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | Na.C9H12N5O4 |
| Net Charge | 0 |
| Average Mass | 277.216 |
| Monoisotopic Mass | 277.07870 |
| SMILES | Nc1nc([O-])c2ncn(COC(CO)CO)c2n1.[Na+] |
| InChI | InChI=1S/C9H13N5O4.Na/c10-9-12-7-6(8(17)13-9)11-3-14(7)4-18-5(1-15)2-16;/h3,5,15-16H,1-2,4H2,(H3,10,12,13,17);/q;+1/p-1 |
| InChIKey | JJICLMJFIKGAAU-UHFFFAOYSA-M |
| Roles Classification |
|---|
| Applications: | anti-inflammatory agent Any compound that has anti-inflammatory effects. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ganciclovir sodium (CHEBI:749328) has role anti-inflammatory agent (CHEBI:67079) |
| ganciclovir sodium (CHEBI:749328) has role antineoplastic agent (CHEBI:35610) |
| ganciclovir sodium (CHEBI:749328) is a purines (CHEBI:26401) |
| Synonyms | Source |
|---|---|
| Cytovene iv | ChEMBL |
| Ganciclovir (as sodium) | ChEMBL |
| Ganciclovir sodium salt | ChEMBL |
| RS-21592 SODIUM | ChEMBL |