EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:749327 - diatrizoate meglumine
| Formula | C7H17NO5.C11H9I3N2O4 |
| Net Charge | 0 |
| Average Mass | 809.130 |
| Monoisotopic Mass | 808.88032 |
| SMILES | CC(=O)Nc1c(I)c(NC(C)=O)c(I)c(C(=O)O)c1I.CNC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C11H9I3N2O4.C7H17NO5/c1-3(17)15-9-6(12)5(11(19)20)7(13)10(8(9)14)16-4(2)18;1-8-2-4(10)6(12)7(13)5(11)3-9/h1-2H3,(H,15,17)(H,16,18)(H,19,20);4-13H,2-3H2,1H3/t;4-,5+,6+,7+/m.0/s1 |
| InChIKey | MIKKOBKEXMRYFQ-WZTVWXICSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Application: | gastrointestinal drug A drug used for its effects on the gastrointestinal system, e.g. controlling gastric acidity, regulating gastrointestinal motility and water flow, and improving digestion. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| diatrizoate meglumine (CHEBI:749327) has role gastrointestinal drug (CHEBI:55324) |
| diatrizoate meglumine (CHEBI:749327) is a amidobenzoic acid (CHEBI:48470) |
| Synonyms | Source |
|---|---|
| Diatrizoic acid meglumine salt | ChEMBL |
| Meglumine amidotrizoate | ChEMBL |
| Meglumine amidotrizoate injection | ChEMBL |
| Brand Names | Source |
|---|---|
| Angiovist 282 | ChEMBL |
| Cardiografin | ChEMBL |
| Cystografin | ChEMBL |
| Cystografin dilute | ChEMBL |
| Diatrizoate meglumine component of angiovist | ChEMBL |
| Diatrizoate meglumine component of gastrografin | ChEMBL |