EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
We are looking for a new Chemistry curator to join the ChEBI team. Find out more about it here.
CHEBI:749324 - spirapril hydrochloride
| Formula | HCl.C22H30N2O5S2 |
| Net Charge | 0 |
| Average Mass | 503.086 |
| Monoisotopic Mass | 502.13629 |
| SMILES | CCOC(=O)[C@H](CCc1ccccc1)N[C@@H](C)C(=O)N1CC2(C[C@H]1C(=O)O)SCCS2.Cl |
| InChI | InChI=1S/C22H30N2O5S2.ClH/c1-3-29-21(28)17(10-9-16-7-5-4-6-8-16)23-15(2)19(25)24-14-22(30-11-12-31-22)13-18(24)20(26)27;/h4-8,15,17-18,23H,3,9-14H2,1-2H3,(H,26,27);1H/t15-,17-,18-;/m0./s1 |
| InChIKey | CLDOLNORSLLQDI-OOAIBONUSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| spirapril hydrochloride (CHEBI:749324) is a dipeptide (CHEBI:46761) |
| Synonyms | Source |
|---|---|
| SCH 33844 | ChEMBL |
| SCH-33844 | ChEMBL |
| Spirapril hcl | ChEMBL |
| Spirapril hydrochloride | ChEMBL |
| Brand Name | Source |
|---|---|
| Renormax | ChEMBL |
| Citations |
|---|